C20H22Cl2N2O4S — CID 30502848
2-chloro-N-[2-(4-chlorophenoxy)ethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 30502848) has the molecular formula C20H22Cl2N2O4S and a molecular weight of 457.38 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-chlorophenoxy)ethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-(4-chlorophenoxy)ethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30502848 |
| Molecular Formula | C20H22Cl2N2O4S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 2-chloro-N-[2-(4-chlorophenoxy)ethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O4S/c21-15-4-6-16(7-5-15)28-13-10-23-20(25)18-14-17(8-9-19(18)22)29(26,27)24-11-2-1-3-12-24/h4-9,14H,1-3,10-13H2,(H,23,25) |
| InChIKey | MSAUGUKTDFNWGY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|