C20H31ClN4O3S — CID 46387509
5-(azepan-1-ylsulfonyl)-2-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide (PubChem CID 46387509) has the molecular formula C20H31ClN4O3S and a molecular weight of 443.01 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 46387509 |
| Molecular Formula | C20H31ClN4O3S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CN1CCN(CCNC(=O)c2cc(S(=O)(=O)N3CCCCCC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H31ClN4O3S/c1-23-12-14-24(15-13-23)11-8-22-20(26)18-16-17(6-7-19(18)21)29(27,28)25-9-4-2-3-5-10-25/h6-7,16H,2-5,8-15H2,1H3,(H,22,26) |
| InChIKey | XFRMQTSKTDIGHY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |