C17H26ClN3O4S — CID 99969395
2-chloro-N-(3-ethoxypropyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 99969395) has the molecular formula C17H26ClN3O4S and a molecular weight of 403.93 g/mol. Its IUPAC name is 2-chloro-N-(3-ethoxypropyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | 2-chloro-N-(3-ethoxypropyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 99969395 |
| Molecular Formula | C17H26ClN3O4S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-chloro-N-(3-ethoxypropyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CCOCCCNC(=O)c1cc(S(=O)(=O)N2CCN(C)CC2)ccc1Cl |
| InChI | InChI=1S/C17H26ClN3O4S/c1-3-25-12-4-7-19-17(22)15-13-14(5-6-16(15)18)26(23,24)21-10-8-20(2)9-11-21/h5-6,13H,3-4,7-12H2,1-2H3,(H,19,22) |
| InChIKey | MWMSRYLNFXJYGP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|