C11H13Cl2NO4S — CID 65371525
4-chloro-3-(2-ethoxyethylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65371525) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 4-chloro-3-(2-ethoxyethylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 4-chloro-3-(2-ethoxyethylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65371525 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-chloro-3-(2-ethoxyethylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CCOCCNC(=O)c1cc(S(=O)(=O)Cl)ccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO4S/c1-2-18-6-5-14-11(15)9-7-8(19(13,16)17)3-4-10(9)12/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | KVBFMHMRKFHQTH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|