C13H18ClNO5S — CID 65370563
3-(2-ethoxyethylcarbamoyl)-5-(methoxymethyl)benzenesulfonyl chloride (PubChem CID 65370563) has the molecular formula C13H18ClNO5S and a molecular weight of 335.81 g/mol. Its IUPAC name is 3-(2-ethoxyethylcarbamoyl)-5-(methoxymethyl)benzenesulfonyl chloride.
| Compound Name | 3-(2-ethoxyethylcarbamoyl)-5-(methoxymethyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370563 |
| Molecular Formula | C13H18ClNO5S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 3-(2-ethoxyethylcarbamoyl)-5-(methoxymethyl)benzenesulfonyl chloride |
| SMILES | CCOCCNC(=O)c1cc(COC)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H18ClNO5S/c1-3-20-5-4-15-13(16)11-6-10(9-19-2)7-12(8-11)21(14,17)18/h6-8H,3-5,9H2,1-2H3,(H,15,16) |
| InChIKey | UTMUSZNWKIIRCL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|