C10H12ClNO3S — CID 65368215
3-(ethylcarbamoyl)-5-methylbenzenesulfonyl chloride (PubChem CID 65368215) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is 3-(ethylcarbamoyl)-5-methylbenzenesulfonyl chloride.
| Compound Name | 3-(ethylcarbamoyl)-5-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65368215 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 3-(ethylcarbamoyl)-5-methylbenzenesulfonyl chloride |
| SMILES | CCNC(=O)c1cc(C)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C10H12ClNO3S/c1-3-12-10(13)8-4-7(2)5-9(6-8)16(11,14)15/h4-6H,3H2,1-2H3,(H,12,13) |
| InChIKey | ALMMWSZFVSIRJW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |