C14H18ClNO3S — CID 114546480
3-methyl-5-[(3-methylcyclopentyl)carbamoyl]benzenesulfonyl chloride (PubChem CID 114546480) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 3-methyl-5-[(3-methylcyclopentyl)carbamoyl]benzenesulfonyl chloride.
| Compound Name | 3-methyl-5-[(3-methylcyclopentyl)carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 114546480 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-methyl-5-[(3-methylcyclopentyl)carbamoyl]benzenesulfonyl chloride |
| SMILES | Cc1cc(C(=O)NC2CCC(C)C2)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C14H18ClNO3S/c1-9-3-4-12(6-9)16-14(17)11-5-10(2)7-13(8-11)20(15,18)19/h5,7-9,12H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | KCXRNPAAJIUHPR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |