C11H16N2O5S2 — CID 65386461
3-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide (PubChem CID 65386461) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide.
| Compound Name | 3-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65386461 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)NCCS(C)(=O)=O)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-8-5-9(7-10(6-8)20(12,17)18)11(14)13-3-4-19(2,15)16/h5-7H,3-4H2,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | QJGIYSLCMZTYGM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |