C12H18N2O5S2 — CID 62045621
2,4-dimethyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide (PubChem CID 62045621) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2,4-dimethyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-dimethyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 62045621 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2,4-dimethyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C12H18N2O5S2/c1-8-6-9(2)11(21(13,18)19)7-10(8)12(15)14-4-5-20(3,16)17/h6-7H,4-5H2,1-3H3,(H,14,15)(H2,13,18,19) |
| InChIKey | FHOJCFBNYWXIML-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |