C11H15ClN2O5S2 — CID 107100939
3-chloro-2-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide (PubChem CID 107100939) has the molecular formula C11H15ClN2O5S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-2-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 107100939 |
| Molecular Formula | C11H15ClN2O5S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-chloro-2-methyl-N-(2-methylsulfonylethyl)-5-sulfamoylbenzamide |
| SMILES | Cc1c(Cl)cc(S(N)(=O)=O)cc1C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C11H15ClN2O5S2/c1-7-9(11(15)14-3-4-20(2,16)17)5-8(6-10(7)12)21(13,18)19/h5-6H,3-4H2,1-2H3,(H,14,15)(H2,13,18,19) |
| InChIKey | SKAQQQMSSDWRNN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |