C14H19Cl2NO3S — CID 107100668
3-chloro-4-methyl-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride (PubChem CID 107100668) has the molecular formula C14H19Cl2NO3S and a molecular weight of 352.28 g/mol. Its IUPAC name is 3-chloro-4-methyl-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-methyl-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 107100668 |
| Molecular Formula | C14H19Cl2NO3S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 3-chloro-4-methyl-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)Cl)cc1C(=O)NCCCC(C)C |
| InChI | InChI=1S/C14H19Cl2NO3S/c1-9(2)5-4-6-17-14(18)12-7-11(21(16,19)20)8-13(15)10(12)3/h7-9H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | USWAMPRYCGDESL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|