C13H16Cl3NO3S — CID 65396081
2,4-dichloro-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65396081) has the molecular formula C13H16Cl3NO3S and a molecular weight of 372.70 g/mol. Its IUPAC name is 2,4-dichloro-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,4-dichloro-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65396081 |
| Molecular Formula | C13H16Cl3NO3S |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2,4-dichloro-5-(4-methylpentylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CC(C)CCCNC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl3NO3S/c1-8(2)4-3-5-17-13(18)9-6-12(21(16,19)20)11(15)7-10(9)14/h6-8H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | IRCRTBXYLDYDNE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|