C12H14Cl3NO3S — CID 65370659
2,4-dichloro-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65370659) has the molecular formula C12H14Cl3NO3S and a molecular weight of 358.67 g/mol. Its IUPAC name is 2,4-dichloro-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,4-dichloro-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370659 |
| Molecular Formula | C12H14Cl3NO3S |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 2,4-dichloro-5-(pentan-3-ylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CCC(CC)NC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3NO3S/c1-3-7(4-2)16-12(17)8-5-11(20(15,18)19)10(14)6-9(8)13/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | OUEVUNJQXSPGQC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |