C13H18Cl2N2O3S — CID 63297293
2,4-dichloro-N-hexan-3-yl-5-sulfamoylbenzamide (PubChem CID 63297293) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2,4-dichloro-N-hexan-3-yl-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N-hexan-3-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 63297293 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2,4-dichloro-N-hexan-3-yl-5-sulfamoylbenzamide |
| SMILES | CCCC(CC)NC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-3-5-8(4-2)17-13(18)9-6-12(21(16,19)20)11(15)7-10(9)14/h6-8H,3-5H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | LWVGTORPHHMSTB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |