C11H14Cl2N2O4S — CID 60637644
2,4-dichloro-N-(1-methoxypropan-2-yl)-5-sulfamoylbenzamide (PubChem CID 60637644) has the molecular formula C11H14Cl2N2O4S and a molecular weight of 341.22 g/mol. Its IUPAC name is 2,4-dichloro-N-(1-methoxypropan-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2,4-dichloro-N-(1-methoxypropan-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 60637644 |
| Molecular Formula | C11H14Cl2N2O4S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2,4-dichloro-N-(1-methoxypropan-2-yl)-5-sulfamoylbenzamide |
| SMILES | COCC(C)NC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O4S/c1-6(5-19-2)15-11(16)7-3-10(20(14,17)18)9(13)4-8(7)12/h3-4,6H,5H2,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | LNOUNZAVGPBWTI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |