3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate

C11H13Cl2NO5S — CID 65381030

IUPAC3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate
SMILESCOCCCOC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl
InChIInChI=1S/C11H13Cl2NO5S/c1-18-3-2-4-19-11(15)7-5-10(20(14,16)17)9(13)6-8(7)12/h5-6H,2-4H2,1H3,(H2,14,16,17)
InChIKeyRKTNSOZOUHEDGQ-UHFFFAOYSA-N
MW342.20 g/mol
LogP1.83
Rot. Bonds6

About 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate

3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate (PubChem CID 65381030) has the molecular formula C11H13Cl2NO5S and a molecular weight of 342.20 g/mol. Its IUPAC name is 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate.

Molecular Properties

Compound Name3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate
PubChem CID65381030
Molecular FormulaC11H13Cl2NO5S
Molecular Weight342.20 g/mol
Exact Mass340.99
IUPAC Name3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate
SMILESCOCCCOC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl
InChIInChI=1S/C11H13Cl2NO5S/c1-18-3-2-4-19-11(15)7-5-10(20(14,16)17)9(13)6-8(7)12/h5-6H,2-4H2,1H3,(H2,14,16,17)
InChIKeyRKTNSOZOUHEDGQ-UHFFFAOYSA-N
XLogP1.83
TPSA95.69 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.20
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate?
The IUPAC name of 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate (CID 65381030) is 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate.
What is the SMILES notation for 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate?
The canonical SMILES for 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate is COCCCOC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl.
What is the InChIKey of 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate?
The InChIKey is RKTNSOZOUHEDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO5S/c1-18-3-2-4-19-11(15)7-5-10(20(14,16)17)9(13)6-8(7)12/h5-6H,2-4H2,1H3,(H2,14,16,17).
What are the key properties of 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate?
3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate has a molecular weight of 342.20 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 2,4-dichloro-5-sulfamoylbenzoate is sourced from PubChem (CID 65381030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).