C13H15Cl3O4S — CID 65375280
hexyl 2,4-dichloro-5-chlorosulfonylbenzoate (PubChem CID 65375280) has the molecular formula C13H15Cl3O4S and a molecular weight of 373.69 g/mol. Its IUPAC name is hexyl 2,4-dichloro-5-chlorosulfonylbenzoate.
| Compound Name | hexyl 2,4-dichloro-5-chlorosulfonylbenzoate |
|---|---|
| PubChem CID | 65375280 |
| Molecular Formula | C13H15Cl3O4S |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | hexyl 2,4-dichloro-5-chlorosulfonylbenzoate |
| SMILES | CCCCCCOC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl3O4S/c1-2-3-4-5-6-20-13(17)9-7-12(21(16,18)19)11(15)8-10(9)14/h7-8H,2-6H2,1H3 |
| InChIKey | CYMOJAYIXCTPLQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|