2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate

C12H13Cl3O5S — CID 65375892

IUPAC2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate
SMILESCCCOCCOC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl
InChIInChI=1S/C12H13Cl3O5S/c1-2-3-19-4-5-20-12(16)8-6-11(21(15,17)18)10(14)7-9(8)13/h6-7H,2-5H2,1H3
InChIKeyOAZVLSPYFNASJW-UHFFFAOYSA-N
MW375.66 g/mol
LogP3.50
Rot. Bonds7

About 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate

2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate (PubChem CID 65375892) has the molecular formula C12H13Cl3O5S and a molecular weight of 375.66 g/mol. Its IUPAC name is 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate.

Molecular Properties

Compound Name2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate
PubChem CID65375892
Molecular FormulaC12H13Cl3O5S
Molecular Weight375.66 g/mol
Exact Mass373.95
IUPAC Name2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate
SMILESCCCOCCOC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl
InChIInChI=1S/C12H13Cl3O5S/c1-2-3-19-4-5-20-12(16)8-6-11(21(15,17)18)10(14)7-9(8)13/h6-7H,2-5H2,1H3
InChIKeyOAZVLSPYFNASJW-UHFFFAOYSA-N
XLogP3.50
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500375.66
LogP ≤ 53.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate?
The IUPAC name of 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate (CID 65375892) is 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate.
What is the SMILES notation for 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate?
The canonical SMILES for 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate is CCCOCCOC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl.
What is the InChIKey of 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate?
The InChIKey is OAZVLSPYFNASJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl3O5S/c1-2-3-19-4-5-20-12(16)8-6-11(21(15,17)18)10(14)7-9(8)13/h6-7H,2-5H2,1H3.
What are the key properties of 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate?
2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate has a molecular weight of 375.66 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate is sourced from PubChem (CID 65375892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).