C12H13Cl3O5S — CID 65375892
2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate (PubChem CID 65375892) has the molecular formula C12H13Cl3O5S and a molecular weight of 375.66 g/mol. Its IUPAC name is 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate.
| Compound Name | 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate |
|---|---|
| PubChem CID | 65375892 |
| Molecular Formula | C12H13Cl3O5S |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2-propoxyethyl 2,4-dichloro-5-chlorosulfonylbenzoate |
| SMILES | CCCOCCOC(=O)c1cc(S(=O)(=O)Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl3O5S/c1-2-3-19-4-5-20-12(16)8-6-11(21(15,17)18)10(14)7-9(8)13/h6-7H,2-5H2,1H3 |
| InChIKey | OAZVLSPYFNASJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|