C14H19ClO5S — CID 65375891
2-propoxyethyl 5-chlorosulfonyl-2,3-dimethylbenzoate (PubChem CID 65375891) has the molecular formula C14H19ClO5S and a molecular weight of 334.82 g/mol. Its IUPAC name is 2-propoxyethyl 5-chlorosulfonyl-2,3-dimethylbenzoate.
| Compound Name | 2-propoxyethyl 5-chlorosulfonyl-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 65375891 |
| Molecular Formula | C14H19ClO5S |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-propoxyethyl 5-chlorosulfonyl-2,3-dimethylbenzoate |
| SMILES | CCCOCCOC(=O)c1cc(S(=O)(=O)Cl)cc(C)c1C |
| InChI | InChI=1S/C14H19ClO5S/c1-4-5-19-6-7-20-14(16)13-9-12(21(15,17)18)8-10(2)11(13)3/h8-9H,4-7H2,1-3H3 |
| InChIKey | NDABSLIBNJHLTN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|