C14H19ClO4S — CID 65398507
3-methylbutyl 5-chlorosulfonyl-2,3-dimethylbenzoate (PubChem CID 65398507) has the molecular formula C14H19ClO4S and a molecular weight of 318.82 g/mol. Its IUPAC name is 3-methylbutyl 5-chlorosulfonyl-2,3-dimethylbenzoate.
| Compound Name | 3-methylbutyl 5-chlorosulfonyl-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 65398507 |
| Molecular Formula | C14H19ClO4S |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-methylbutyl 5-chlorosulfonyl-2,3-dimethylbenzoate |
| SMILES | Cc1cc(S(=O)(=O)Cl)cc(C(=O)OCCC(C)C)c1C |
| InChI | InChI=1S/C14H19ClO4S/c1-9(2)5-6-19-14(16)13-8-12(20(15,17)18)7-10(3)11(13)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | VNLBEXCEAZIOMY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |