C14H18ClFO4S — CID 103286150
2-methylpentyl 5-chlorosulfonyl-2-fluoro-3-methylbenzoate (PubChem CID 103286150) has the molecular formula C14H18ClFO4S and a molecular weight of 336.81 g/mol. Its IUPAC name is 2-methylpentyl 5-chlorosulfonyl-2-fluoro-3-methylbenzoate.
| Compound Name | 2-methylpentyl 5-chlorosulfonyl-2-fluoro-3-methylbenzoate |
|---|---|
| PubChem CID | 103286150 |
| Molecular Formula | C14H18ClFO4S |
| Molecular Weight | 336.81 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-methylpentyl 5-chlorosulfonyl-2-fluoro-3-methylbenzoate |
| SMILES | CCCC(C)COC(=O)c1cc(S(=O)(=O)Cl)cc(C)c1F |
| InChI | InChI=1S/C14H18ClFO4S/c1-4-5-9(2)8-20-14(17)12-7-11(21(15,18)19)6-10(3)13(12)16/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | MHQHCCBWKKCNMQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |