C14H19FO4S — CID 81435096
2-fluoro-3-methyl-5-(2-methylpentylsulfonyl)benzoic acid (PubChem CID 81435096) has the molecular formula C14H19FO4S and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-fluoro-3-methyl-5-(2-methylpentylsulfonyl)benzoic acid.
| Compound Name | 2-fluoro-3-methyl-5-(2-methylpentylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 81435096 |
| Molecular Formula | C14H19FO4S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-fluoro-3-methyl-5-(2-methylpentylsulfonyl)benzoic acid |
| SMILES | CCCC(C)CS(=O)(=O)c1cc(C)c(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H19FO4S/c1-4-5-9(2)8-20(18,19)11-6-10(3)13(15)12(7-11)14(16)17/h6-7,9H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | OOVWRZHJHKPAJF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |