C12H14ClFO4S — CID 81461807
2-chloro-3-fluoro-5-(2-methylbutylsulfonyl)benzoic acid (PubChem CID 81461807) has the molecular formula C12H14ClFO4S and a molecular weight of 308.76 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(2-methylbutylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(2-methylbutylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 81461807 |
| Molecular Formula | C12H14ClFO4S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-chloro-3-fluoro-5-(2-methylbutylsulfonyl)benzoic acid |
| SMILES | CCC(C)CS(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H14ClFO4S/c1-3-7(2)6-19(17,18)8-4-9(12(15)16)11(13)10(14)5-8/h4-5,7H,3,6H2,1-2H3,(H,15,16) |
| InChIKey | GUKITUQPWCFCKR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |