C10H7ClF4O4S2 — CID 116616541
2-chloro-3-fluoro-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid (PubChem CID 116616541) has the molecular formula C10H7ClF4O4S2 and a molecular weight of 366.74 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 116616541 |
| Molecular Formula | C10H7ClF4O4S2 |
| Molecular Weight | 366.74 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 2-chloro-3-fluoro-5-[2-(trifluoromethylsulfanyl)ethylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)CCSC(F)(F)F)cc(F)c1Cl |
| InChI | InChI=1S/C10H7ClF4O4S2/c11-8-6(9(16)17)3-5(4-7(8)12)21(18,19)2-1-20-10(13,14)15/h3-4H,1-2H2,(H,16,17) |
| InChIKey | JPQBRWDAJLZMFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |