C10H6ClFO4S — CID 81461418
2-chloro-3-fluoro-5-prop-2-ynylsulfonylbenzoic acid (PubChem CID 81461418) has the molecular formula C10H6ClFO4S and a molecular weight of 276.67 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-prop-2-ynylsulfonylbenzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-prop-2-ynylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 81461418 |
| Molecular Formula | C10H6ClFO4S |
| Molecular Weight | 276.67 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 2-chloro-3-fluoro-5-prop-2-ynylsulfonylbenzoic acid |
| SMILES | C#CCS(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H6ClFO4S/c1-2-3-17(15,16)6-4-7(10(13)14)9(11)8(12)5-6/h1,4-5H,3H2,(H,13,14) |
| InChIKey | FEALLSAIBKNZJI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|