C10H10ClFO6S2 — CID 81461959
2-chloro-3-fluoro-5-(2-methylsulfonylethylsulfonyl)benzoic acid (PubChem CID 81461959) has the molecular formula C10H10ClFO6S2 and a molecular weight of 344.77 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(2-methylsulfonylethylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(2-methylsulfonylethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 81461959 |
| Molecular Formula | C10H10ClFO6S2 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 2-chloro-3-fluoro-5-(2-methylsulfonylethylsulfonyl)benzoic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H10ClFO6S2/c1-19(15,16)2-3-20(17,18)6-4-7(10(13)14)9(11)8(12)5-6/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | MCMBKRBLBWNNCB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |