C11H10ClFO4S — CID 81461957
2-chloro-5-(cyclopropylmethylsulfonyl)-3-fluorobenzoic acid (PubChem CID 81461957) has the molecular formula C11H10ClFO4S and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-chloro-5-(cyclopropylmethylsulfonyl)-3-fluorobenzoic acid.
| Compound Name | 2-chloro-5-(cyclopropylmethylsulfonyl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 81461957 |
| Molecular Formula | C11H10ClFO4S |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-chloro-5-(cyclopropylmethylsulfonyl)-3-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)CC2CC2)cc(F)c1Cl |
| InChI | InChI=1S/C11H10ClFO4S/c12-10-8(11(14)15)3-7(4-9(10)13)18(16,17)5-6-1-2-6/h3-4,6H,1-2,5H2,(H,14,15) |
| InChIKey | ICQAGUIYRVQDQC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |