C13H14ClFO5S — CID 81451931
2-chloro-3-fluoro-5-(oxan-2-ylmethylsulfonyl)benzoic acid (PubChem CID 81451931) has the molecular formula C13H14ClFO5S and a molecular weight of 336.77 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(oxan-2-ylmethylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(oxan-2-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 81451931 |
| Molecular Formula | C13H14ClFO5S |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-chloro-3-fluoro-5-(oxan-2-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)CC2CCCCO2)cc(F)c1Cl |
| InChI | InChI=1S/C13H14ClFO5S/c14-12-10(13(16)17)5-9(6-11(12)15)21(18,19)7-8-3-1-2-4-20-8/h5-6,8H,1-4,7H2,(H,16,17) |
| InChIKey | RBLBQQAIIRHGRF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |