C13H14Cl2O5S — CID 65163000
2,5-dichloro-3-[2-(oxolan-2-yl)ethylsulfonyl]benzoic acid (PubChem CID 65163000) has the molecular formula C13H14Cl2O5S and a molecular weight of 353.22 g/mol. Its IUPAC name is 2,5-dichloro-3-[2-(oxolan-2-yl)ethylsulfonyl]benzoic acid.
| Compound Name | 2,5-dichloro-3-[2-(oxolan-2-yl)ethylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 65163000 |
| Molecular Formula | C13H14Cl2O5S |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2,5-dichloro-3-[2-(oxolan-2-yl)ethylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)CCC2CCCO2)c1Cl |
| InChI | InChI=1S/C13H14Cl2O5S/c14-8-6-10(13(16)17)12(15)11(7-8)21(18,19)5-3-9-2-1-4-20-9/h6-7,9H,1-5H2,(H,16,17) |
| InChIKey | QHZIOJWDHJSTDL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |