C12H16FNO3S — CID 81185902
5-fluoro-2-[2-(oxolan-2-yl)ethylsulfonyl]aniline (PubChem CID 81185902) has the molecular formula C12H16FNO3S and a molecular weight of 273.33 g/mol. Its IUPAC name is 5-fluoro-2-[2-(oxolan-2-yl)ethylsulfonyl]aniline.
| Compound Name | 5-fluoro-2-[2-(oxolan-2-yl)ethylsulfonyl]aniline |
|---|---|
| PubChem CID | 81185902 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 5-fluoro-2-[2-(oxolan-2-yl)ethylsulfonyl]aniline |
| SMILES | Nc1cc(F)ccc1S(=O)(=O)CCC1CCCO1 |
| InChI | InChI=1S/C12H16FNO3S/c13-9-3-4-12(11(14)8-9)18(15,16)7-5-10-2-1-6-17-10/h3-4,8,10H,1-2,5-7,14H2 |
| InChIKey | DWOAWBBBRQWCFM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|