C12H17NO3S — CID 81180714
5-methyl-2-(oxolan-2-ylmethylsulfonyl)aniline (PubChem CID 81180714) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-methyl-2-(oxolan-2-ylmethylsulfonyl)aniline.
| Compound Name | 5-methyl-2-(oxolan-2-ylmethylsulfonyl)aniline |
|---|---|
| PubChem CID | 81180714 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 5-methyl-2-(oxolan-2-ylmethylsulfonyl)aniline |
| SMILES | Cc1ccc(S(=O)(=O)CC2CCCO2)c(N)c1 |
| InChI | InChI=1S/C12H17NO3S/c1-9-4-5-12(11(13)7-9)17(14,15)8-10-3-2-6-16-10/h4-5,7,10H,2-3,6,8,13H2,1H3 |
| InChIKey | NMLLBIAXIOFHFT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|