C10H14N2O3S — CID 61367073
2-(oxolan-2-ylmethylsulfonyl)pyridin-3-amine (PubChem CID 61367073) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfonyl)pyridin-3-amine.
| Compound Name | 2-(oxolan-2-ylmethylsulfonyl)pyridin-3-amine |
|---|---|
| PubChem CID | 61367073 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfonyl)pyridin-3-amine |
| SMILES | Nc1cccnc1S(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C10H14N2O3S/c11-9-4-1-5-12-10(9)16(13,14)7-8-3-2-6-15-8/h1,4-5,8H,2-3,6-7,11H2 |
| InChIKey | HHWDQRNCERGEJC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |