C10H15N3O3S — CID 113391859
N-(3-amino-2-pyridinyl)-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 113391859) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(3-amino-2-pyridinyl)-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-(3-amino-2-pyridinyl)-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 113391859 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(3-amino-2-pyridinyl)-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | Nc1cccnc1NS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C10H15N3O3S/c11-9-4-1-5-12-10(9)13-17(14,15)7-8-3-2-6-16-8/h1,4-5,8H,2-3,6-7,11H2,(H,12,13) |
| InChIKey | OLJWPAHXCQDLBU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |