C12H18N2O5S2 — CID 63247225
2-methyl-3-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide (PubChem CID 63247225) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-methyl-3-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide.
| Compound Name | 2-methyl-3-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63247225 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-methyl-3-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)CC2CCCO2)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H18N2O5S2/c1-9-11(5-2-6-12(9)21(13,17)18)14-20(15,16)8-10-4-3-7-19-10/h2,5-6,10,14H,3-4,7-8H2,1H3,(H2,13,17,18) |
| InChIKey | FOXSJWROBGYROY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |