C11H16N2O5S2 — CID 63247383
4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide (PubChem CID 63247383) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide.
| Compound Name | 4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63247383 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)CC2CCCO2)cc1 |
| InChI | InChI=1S/C11H16N2O5S2/c12-20(16,17)11-5-3-9(4-6-11)13-19(14,15)8-10-2-1-7-18-10/h3-6,10,13H,1-2,7-8H2,(H2,12,16,17) |
| InChIKey | LEIINNNWUGPXJS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |