C11H15ClN2O5S2 — CID 63247341
3-chloro-4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide (PubChem CID 63247341) has the molecular formula C11H15ClN2O5S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-chloro-4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-chloro-4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63247341 |
| Molecular Formula | C11H15ClN2O5S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-chloro-4-(oxolan-2-ylmethylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)CC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O5S2/c12-10-6-9(21(13,17)18)3-4-11(10)14-20(15,16)7-8-2-1-5-19-8/h3-4,6,8,14H,1-2,5,7H2,(H2,13,17,18) |
| InChIKey | FHVQEMMETHYMKB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |