C11H13ClINO3S — CID 113238115
N-(2-chloro-4-iodophenyl)-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 113238115) has the molecular formula C11H13ClINO3S and a molecular weight of 401.65 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 113238115 |
| Molecular Formula | C11H13ClINO3S |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 400.93 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCO1)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C11H13ClINO3S/c12-10-6-8(13)3-4-11(10)14-18(15,16)7-9-2-1-5-17-9/h3-4,6,9,14H,1-2,5,7H2 |
| InChIKey | MFZWONJUPLYZBK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|