C11H14FNO5S2 — CID 116814305
2-(oxolan-2-ylmethylsulfonylamino)benzenesulfonyl fluoride (PubChem CID 116814305) has the molecular formula C11H14FNO5S2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfonylamino)benzenesulfonyl fluoride.
| Compound Name | 2-(oxolan-2-ylmethylsulfonylamino)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116814305 |
| Molecular Formula | C11H14FNO5S2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfonylamino)benzenesulfonyl fluoride |
| SMILES | O=S(=O)(CC1CCCO1)Nc1ccccc1S(=O)(=O)F |
| InChI | InChI=1S/C11H14FNO5S2/c12-20(16,17)11-6-2-1-5-10(11)13-19(14,15)8-9-4-3-7-18-9/h1-2,5-6,9,13H,3-4,7-8H2 |
| InChIKey | ZFVWXWVOZZNVDB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |