C12H14F2N2O4S — CID 127266011
4,5-difluoro-2-(oxolan-2-ylmethylsulfonylamino)benzamide (PubChem CID 127266011) has the molecular formula C12H14F2N2O4S and a molecular weight of 320.32 g/mol. Its IUPAC name is 4,5-difluoro-2-(oxolan-2-ylmethylsulfonylamino)benzamide.
| Compound Name | 4,5-difluoro-2-(oxolan-2-ylmethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 127266011 |
| Molecular Formula | C12H14F2N2O4S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4,5-difluoro-2-(oxolan-2-ylmethylsulfonylamino)benzamide |
| SMILES | NC(=O)c1cc(F)c(F)cc1NS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C12H14F2N2O4S/c13-9-4-8(12(15)17)11(5-10(9)14)16-21(18,19)6-7-2-1-3-20-7/h4-5,7,16H,1-3,6H2,(H2,15,17) |
| InChIKey | CQONBWATSGRPJN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |