C9H14N4O3S2 — CID 79499481
5-(oxolan-2-ylmethylsulfonylamino)-1H-pyrazole-4-carbothioamide (PubChem CID 79499481) has the molecular formula C9H14N4O3S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-(oxolan-2-ylmethylsulfonylamino)-1H-pyrazole-4-carbothioamide.
| Compound Name | 5-(oxolan-2-ylmethylsulfonylamino)-1H-pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 79499481 |
| Molecular Formula | C9H14N4O3S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-(oxolan-2-ylmethylsulfonylamino)-1H-pyrazole-4-carbothioamide |
| SMILES | NC(=S)c1cn[nH]c1NS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C9H14N4O3S2/c10-8(17)7-4-11-12-9(7)13-18(14,15)5-6-2-1-3-16-6/h4,6H,1-3,5H2,(H2,10,17)(H2,11,12,13) |
| InChIKey | UDBDYTJGPIZCJF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|