C11H14N2O5S — CID 63654102
2-(oxolan-2-ylmethylsulfonylamino)pyridine-3-carboxylic acid (PubChem CID 63654102) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfonylamino)pyridine-3-carboxylic acid.
| Compound Name | 2-(oxolan-2-ylmethylsulfonylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63654102 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfonylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1NS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C11H14N2O5S/c14-11(15)9-4-1-5-12-10(9)13-19(16,17)7-8-3-2-6-18-8/h1,4-5,8H,2-3,6-7H2,(H,12,13)(H,14,15) |
| InChIKey | DBIFHKPYIZMTKG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |