C11H13NO3S — CID 40605283
2-[[(2S)-oxolan-2-yl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 40605283) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2S)-oxolan-2-yl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 40605283 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SC[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H13NO3S/c13-11(14)9-4-1-5-12-10(9)16-7-8-3-2-6-15-8/h1,4-5,8H,2-3,6-7H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | KRQSOKPUQSDAEO-QMMMGPOBSA-N |
| XLogP | 2.05 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |