C12H15NO3S — CID 43241352
2-(oxan-2-ylmethylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 43241352) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-(oxan-2-ylmethylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(oxan-2-ylmethylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 43241352 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-(oxan-2-ylmethylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCC1CCCCO1 |
| InChI | InChI=1S/C12H15NO3S/c14-12(15)10-5-3-6-13-11(10)17-8-9-4-1-2-7-16-9/h3,5-6,9H,1-2,4,7-8H2,(H,14,15) |
| InChIKey | FRAYHILVGNBKPA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |