C8H11ClN2O6S3 — CID 82843552
3-chloro-4-(methylsulfonylmethylsulfonylamino)benzenesulfonamide (PubChem CID 82843552) has the molecular formula C8H11ClN2O6S3 and a molecular weight of 362.84 g/mol. Its IUPAC name is 3-chloro-4-(methylsulfonylmethylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-chloro-4-(methylsulfonylmethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 82843552 |
| Molecular Formula | C8H11ClN2O6S3 |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 3-chloro-4-(methylsulfonylmethylsulfonylamino)benzenesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C8H11ClN2O6S3/c1-18(12,13)5-19(14,15)11-8-3-2-6(4-7(8)9)20(10,16)17/h2-4,11H,5H2,1H3,(H2,10,16,17) |
| InChIKey | DSXQXNYJGARCHK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |