C7H8BrClN2O4S2 — CID 63666622
3-bromo-4-(chloromethylsulfonylamino)benzenesulfonamide (PubChem CID 63666622) has the molecular formula C7H8BrClN2O4S2 and a molecular weight of 363.64 g/mol. Its IUPAC name is 3-bromo-4-(chloromethylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-bromo-4-(chloromethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63666622 |
| Molecular Formula | C7H8BrClN2O4S2 |
| Molecular Weight | 363.64 g/mol |
| Exact Mass | 361.88 |
| IUPAC Name | 3-bromo-4-(chloromethylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)CCl)c(Br)c1 |
| InChI | InChI=1S/C7H8BrClN2O4S2/c8-6-3-5(17(10,14)15)1-2-7(6)11-16(12,13)4-9/h1-3,11H,4H2,(H2,10,14,15) |
| InChIKey | PYGKCQVRRLNZAY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.64 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|