C9H11BrClNO5S2 — CID 55014257
3-bromo-4-(2-methoxyethylsulfonylamino)benzenesulfonyl chloride (PubChem CID 55014257) has the molecular formula C9H11BrClNO5S2 and a molecular weight of 392.68 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 3-bromo-4-(2-methoxyethylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 55014257 |
| Molecular Formula | C9H11BrClNO5S2 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | 3-bromo-4-(2-methoxyethylsulfonylamino)benzenesulfonyl chloride |
| SMILES | COCCS(=O)(=O)Nc1ccc(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C9H11BrClNO5S2/c1-17-4-5-18(13,14)12-9-3-2-7(6-8(9)10)19(11,15)16/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | NLUKPOQKCSVEST-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |