C11H16ClNO5S2 — CID 43322394
3-(butylsulfonylamino)-4-methoxybenzenesulfonyl chloride (PubChem CID 43322394) has the molecular formula C11H16ClNO5S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-(butylsulfonylamino)-4-methoxybenzenesulfonyl chloride.
| Compound Name | 3-(butylsulfonylamino)-4-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 43322394 |
| Molecular Formula | C11H16ClNO5S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-(butylsulfonylamino)-4-methoxybenzenesulfonyl chloride |
| SMILES | CCCCS(=O)(=O)Nc1cc(S(=O)(=O)Cl)ccc1OC |
| InChI | InChI=1S/C11H16ClNO5S2/c1-3-4-7-19(14,15)13-10-8-9(20(12,16)17)5-6-11(10)18-2/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | LHDIDASLXOGQJA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |