C11H10ClNO5S3 — CID 16771255
4-methoxy-3-(thiophen-2-ylsulfonylamino)benzenesulfonyl chloride (PubChem CID 16771255) has the molecular formula C11H10ClNO5S3 and a molecular weight of 367.86 g/mol. Its IUPAC name is 4-methoxy-3-(thiophen-2-ylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 4-methoxy-3-(thiophen-2-ylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 16771255 |
| Molecular Formula | C11H10ClNO5S3 |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 4-methoxy-3-(thiophen-2-ylsulfonylamino)benzenesulfonyl chloride |
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H10ClNO5S3/c1-18-10-5-4-8(20(12,14)15)7-9(10)13-21(16,17)11-3-2-6-19-11/h2-7,13H,1H3 |
| InChIKey | YWWNISDLYCYURI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |