C13H15NO3S2 — CID 110777538
N-(2-methoxy-3,5-dimethylphenyl)thiophene-2-sulfonamide (PubChem CID 110777538) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2-methoxy-3,5-dimethylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-methoxy-3,5-dimethylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110777538 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(2-methoxy-3,5-dimethylphenyl)thiophene-2-sulfonamide |
| SMILES | COc1c(C)cc(C)cc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H15NO3S2/c1-9-7-10(2)13(17-3)11(8-9)14-19(15,16)12-5-4-6-18-12/h4-8,14H,1-3H3 |
| InChIKey | YLKQKMUXRXIBJJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |