C12H13NO2S2 — CID 765837
N-(2,6-dimethylphenyl)thiophene-2-sulfonamide (PubChem CID 765837) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(2,6-dimethylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 765837 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-(2,6-dimethylphenyl)thiophene-2-sulfonamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H13NO2S2/c1-9-5-3-6-10(2)12(9)13-17(14,15)11-7-4-8-16-11/h3-8,13H,1-2H3 |
| InChIKey | NVHAULCCIGSTGV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |